C20H19N — CID 129384739
(4S)-2-methyl-4-naphthalen-2-yl-3,4-dihydro-1H-isoquinoline (PubChem CID 129384739) has the molecular formula C20H19N and a molecular weight of 273.38 g/mol. Its IUPAC name is (4S)-2-methyl-4-naphthalen-2-yl-3,4-dihydro-1H-isoquinoline.
| Compound Name | (4S)-2-methyl-4-naphthalen-2-yl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 129384739 |
| Molecular Formula | C20H19N |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (4S)-2-methyl-4-naphthalen-2-yl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1Cc2ccccc2[C@H](c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C20H19N/c1-21-13-18-8-4-5-9-19(18)20(14-21)17-11-10-15-6-2-3-7-16(15)12-17/h2-12,20H,13-14H2,1H3/t20-/m0/s1 |
| InChIKey | VKFUPJSKOSFXMT-FQEVSTJZSA-N |
| XLogP | 4.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |