C18H17N3 — CID 68996107
6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoxaline (PubChem CID 68996107) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoxaline.
| Compound Name | 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoxaline |
|---|---|
| PubChem CID | 68996107 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)quinoxaline |
| SMILES | CN1Cc2ccccc2C(c2ccc3nccnc3c2)C1 |
| InChI | InChI=1S/C18H17N3/c1-21-11-14-4-2-3-5-15(14)16(12-21)13-6-7-17-18(10-13)20-9-8-19-17/h2-10,16H,11-12H2,1H3 |
| InChIKey | WKGTXIDZJLADLA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |