C18H18N2 — CID 11615894
4-indolizin-6-yl-2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 11615894) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-indolizin-6-yl-2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 4-indolizin-6-yl-2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 11615894 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-indolizin-6-yl-2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1Cc2ccccc2C(c2ccc3cccn3c2)C1 |
| InChI | InChI=1S/C18H18N2/c1-19-11-14-5-2-3-7-17(14)18(13-19)15-8-9-16-6-4-10-20(16)12-15/h2-10,12,18H,11,13H2,1H3 |
| InChIKey | FNVBFYGTKDWGMA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 7.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |