C21H20N2O4S — CID 131727471
(Z)-but-2-enedioic acid;6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,3-benzothiazole (PubChem CID 131727471) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,3-benzothiazole.
| Compound Name | (Z)-but-2-enedioic acid;6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 131727471 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (Z)-but-2-enedioic acid;6-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-1,3-benzothiazole |
| SMILES | CN1Cc2ccccc2C(c2ccc3ncsc3c2)C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H16N2S.C4H4O4/c1-19-9-13-4-2-3-5-14(13)15(10-19)12-6-7-16-17(8-12)20-11-18-16;5-3(6)1-2-4(7)8/h2-8,11,15H,9-10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | MLUNYAMYYAPIHT-BTJKTKAUSA-N |
| XLogP | 3.59 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|