C21H18F3NO3S — CID 87201660
(2-methyl-4-naphthalen-2-yl-3,4-dihydro-1H-isoquinolin-7-yl) trifluoromethanesulfonate (PubChem CID 87201660) has the molecular formula C21H18F3NO3S and a molecular weight of 421.44 g/mol. Its IUPAC name is (2-methyl-4-naphthalen-2-yl-3,4-dihydro-1H-isoquinolin-7-yl) trifluoromethanesulfonate.
| Compound Name | (2-methyl-4-naphthalen-2-yl-3,4-dihydro-1H-isoquinolin-7-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87201660 |
| Molecular Formula | C21H18F3NO3S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | (2-methyl-4-naphthalen-2-yl-3,4-dihydro-1H-isoquinolin-7-yl) trifluoromethanesulfonate |
| SMILES | CN1Cc2cc(OS(=O)(=O)C(F)(F)F)ccc2C(c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C21H18F3NO3S/c1-25-12-17-11-18(28-29(26,27)21(22,23)24)8-9-19(17)20(13-25)16-7-6-14-4-2-3-5-15(14)10-16/h2-11,20H,12-13H2,1H3 |
| InChIKey | LJKVKBJGEDCUNB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|