C36H28 — CID 170654177
9-(2,3,4,5,6-pentadeuteriophenyl)-10-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]anthracene (PubChem CID 170654177) has the molecular formula C36H28 and a molecular weight of 465.65 g/mol. Its IUPAC name is 9-(2,3,4,5,6-pentadeuteriophenyl)-10-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]anthracene.
| Compound Name | 9-(2,3,4,5,6-pentadeuteriophenyl)-10-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]anthracene |
|---|---|
| PubChem CID | 170654177 |
| Molecular Formula | C36H28 |
| Molecular Weight | 465.65 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 9-(2,3,4,5,6-pentadeuteriophenyl)-10-[3-(1,2,3,4-tetrahydronaphthalen-1-yl)phenyl]anthracene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3cccc(C4CCCc5ccccc54)c3)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C36H28/c1-2-13-26(14-3-1)35-31-19-6-8-21-33(31)36(34-22-9-7-20-32(34)35)28-17-10-16-27(24-28)30-23-11-15-25-12-4-5-18-29(25)30/h1-10,12-14,16-22,24,30H,11,15,23H2/i1D,2D,3D,13D,14D |
| InChIKey | LWQXBAJIDHTTMV-NDWIIPQNSA-N |
| XLogP | 9.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.65 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|