C48H35N — CID 169070785
2-ethyl-3-[3-[3-[3-(2,3,4,5,6-pentadeuteriophenyl)-10-phenylanthracen-9-yl]phenyl]phenyl]-3H-indole (PubChem CID 169070785) has the molecular formula C48H35N and a molecular weight of 630.85 g/mol. Its IUPAC name is 2-ethyl-3-[3-[3-[3-(2,3,4,5,6-pentadeuteriophenyl)-10-phenylanthracen-9-yl]phenyl]phenyl]-3H-indole.
| Compound Name | 2-ethyl-3-[3-[3-[3-(2,3,4,5,6-pentadeuteriophenyl)-10-phenylanthracen-9-yl]phenyl]phenyl]-3H-indole |
|---|---|
| PubChem CID | 169070785 |
| Molecular Formula | C48H35N |
| Molecular Weight | 630.85 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | 2-ethyl-3-[3-[3-[3-(2,3,4,5,6-pentadeuteriophenyl)-10-phenylanthracen-9-yl]phenyl]phenyl]-3H-indole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(-c4cccc(-c5cccc(C6C(CC)=Nc7ccccc76)c5)c4)c4ccccc4c(-c4ccccc4)c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C48H35N/c1-2-44-48(42-25-11-12-26-45(42)49-44)38-22-14-20-35(30-38)34-19-13-21-37(29-34)47-40-24-10-9-23-39(40)46(33-17-7-4-8-18-33)43-31-36(27-28-41(43)47)32-15-5-3-6-16-32/h3-31,48H,2H2,1H3/i3D,5D,6D,15D,16D |
| InChIKey | NHNOZSBVHNQIEA-JXPHPVJHSA-N |
| XLogP | 13.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.85 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|