C24H26N4 — CID 68967026
5,6-bis[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrimidine-2,4-diamine (PubChem CID 68967026) has the molecular formula C24H26N4 and a molecular weight of 370.50 g/mol. Its IUPAC name is 5,6-bis[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrimidine-2,4-diamine.
| Compound Name | 5,6-bis[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68967026 |
| Molecular Formula | C24H26N4 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 5,6-bis[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(N)c([C@@H]2CCCc3ccccc32)c([C@@H]2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C24H26N4/c25-23-21(19-13-5-9-15-7-1-3-11-17(15)19)22(27-24(26)28-23)20-14-6-10-16-8-2-4-12-18(16)20/h1-4,7-8,11-12,19-20H,5-6,9-10,13-14H2,(H4,25,26,27,28)/t19-,20-/m1/s1 |
| InChIKey | LCKUCPKNYISAMT-WOJBJXKFSA-N |
| XLogP | 4.58 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |