C15H18N6OS — CID 7415664
2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 7415664) has the molecular formula C15H18N6OS and a molecular weight of 330.42 g/mol. Its IUPAC name is 2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 7415664 |
| Molecular Formula | C15H18N6OS |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | Nc1nc(N)nc(SCC(=O)N[C@H]2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C15H18N6OS/c16-13-19-14(17)21-15(20-13)23-8-12(22)18-11-7-3-5-9-4-1-2-6-10(9)11/h1-2,4,6,11H,3,5,7-8H2,(H,18,22)(H4,16,17,19,20,21)/t11-/m0/s1 |
| InChIKey | UUTAJNXXRACTAJ-NSHDSACASA-N |
| XLogP | 1.32 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |