C19H19NOS2 — CID 3819603
[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] benzenecarbodithioate (PubChem CID 3819603) has the molecular formula C19H19NOS2 and a molecular weight of 341.50 g/mol. Its IUPAC name is [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] benzenecarbodithioate.
| Compound Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] benzenecarbodithioate |
|---|---|
| PubChem CID | 3819603 |
| Molecular Formula | C19H19NOS2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] benzenecarbodithioate |
| SMILES | O=C(CSC(=S)c1ccccc1)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C19H19NOS2/c21-18(13-23-19(22)15-8-2-1-3-9-15)20-17-12-6-10-14-7-4-5-11-16(14)17/h1-5,7-9,11,17H,6,10,12-13H2,(H,20,21) |
| InChIKey | KEGCBGZSHNXZFZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|