C15H15ClN2 — CID 107615870
3-chloro-4-(5,6,7,8-tetrahydroquinolin-8-yl)aniline (PubChem CID 107615870) has the molecular formula C15H15ClN2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 3-chloro-4-(5,6,7,8-tetrahydroquinolin-8-yl)aniline.
| Compound Name | 3-chloro-4-(5,6,7,8-tetrahydroquinolin-8-yl)aniline |
|---|---|
| PubChem CID | 107615870 |
| Molecular Formula | C15H15ClN2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-chloro-4-(5,6,7,8-tetrahydroquinolin-8-yl)aniline |
| SMILES | Nc1ccc(C2CCCc3cccnc32)c(Cl)c1 |
| InChI | InChI=1S/C15H15ClN2/c16-14-9-11(17)6-7-12(14)13-5-1-3-10-4-2-8-18-15(10)13/h2,4,6-9,13H,1,3,5,17H2 |
| InChIKey | BRMMRMSALFWOII-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|