C13H14N4 — CID 79739845
5-(5,6,7,8-tetrahydroquinolin-8-yl)pyrazin-2-amine (PubChem CID 79739845) has the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. Its IUPAC name is 5-(5,6,7,8-tetrahydroquinolin-8-yl)pyrazin-2-amine.
| Compound Name | 5-(5,6,7,8-tetrahydroquinolin-8-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 79739845 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 5-(5,6,7,8-tetrahydroquinolin-8-yl)pyrazin-2-amine |
| SMILES | Nc1cnc(C2CCCc3cccnc32)cn1 |
| InChI | InChI=1S/C13H14N4/c14-12-8-16-11(7-17-12)10-5-1-3-9-4-2-6-15-13(9)10/h2,4,6-8,10H,1,3,5H2,(H2,14,17) |
| InChIKey | IUQBUQIKZYMTCV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |