C13H13N3O — CID 136769456
4-(5,6,7,8-tetrahydroquinolin-8-yl)-1H-pyrimidin-6-one (PubChem CID 136769456) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydroquinolin-8-yl)-1H-pyrimidin-6-one.
| Compound Name | 4-(5,6,7,8-tetrahydroquinolin-8-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136769456 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-(5,6,7,8-tetrahydroquinolin-8-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C2CCCc3cccnc32)nc[nH]1 |
| InChI | InChI=1S/C13H13N3O/c17-12-7-11(15-8-16-12)10-5-1-3-9-4-2-6-14-13(9)10/h2,4,6-8,10H,1,3,5H2,(H,15,16,17) |
| InChIKey | KDFHIUCEHGOAKB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |