C14H12F3N3S — CID 106776905
6-(5,6,7,8-tetrahydroquinolin-8-yl)-2-(trifluoromethyl)-1H-pyrimidine-4-thione (PubChem CID 106776905) has the molecular formula C14H12F3N3S and a molecular weight of 311.33 g/mol. Its IUPAC name is 6-(5,6,7,8-tetrahydroquinolin-8-yl)-2-(trifluoromethyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-(5,6,7,8-tetrahydroquinolin-8-yl)-2-(trifluoromethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106776905 |
| Molecular Formula | C14H12F3N3S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 6-(5,6,7,8-tetrahydroquinolin-8-yl)-2-(trifluoromethyl)-1H-pyrimidine-4-thione |
| SMILES | FC(F)(F)c1nc(=S)cc(C2CCCc3cccnc32)[nH]1 |
| InChI | InChI=1S/C14H12F3N3S/c15-14(16,17)13-19-10(7-11(21)20-13)9-5-1-3-8-4-2-6-18-12(8)9/h2,4,6-7,9H,1,3,5H2,(H,19,20,21) |
| InChIKey | FQXURNSMUFOBDQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|