C14H15NO — CID 79737986
3-(5,6,7,8-tetrahydroquinolin-8-yl)cyclopent-2-en-1-one (PubChem CID 79737986) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-(5,6,7,8-tetrahydroquinolin-8-yl)cyclopent-2-en-1-one.
| Compound Name | 3-(5,6,7,8-tetrahydroquinolin-8-yl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 79737986 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3-(5,6,7,8-tetrahydroquinolin-8-yl)cyclopent-2-en-1-one |
| SMILES | O=C1C=C(C2CCCc3cccnc32)CC1 |
| InChI | InChI=1S/C14H15NO/c16-12-7-6-11(9-12)13-5-1-3-10-4-2-8-15-14(10)13/h2,4,8-9,13H,1,3,5-7H2 |
| InChIKey | SUWIKOPVDDYZSH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |