C14H16ClN — CID 79738012
7-(3-chlorocyclohexen-1-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 79738012) has the molecular formula C14H16ClN and a molecular weight of 233.74 g/mol. Its IUPAC name is 7-(3-chlorocyclohexen-1-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine.
| Compound Name | 7-(3-chlorocyclohexen-1-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 79738012 |
| Molecular Formula | C14H16ClN |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 7-(3-chlorocyclohexen-1-yl)-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | ClC1C=C(C2CCc3cccnc32)CCC1 |
| InChI | InChI=1S/C14H16ClN/c15-12-5-1-3-11(9-12)13-7-6-10-4-2-8-16-14(10)13/h2,4,8-9,12-13H,1,3,5-7H2 |
| InChIKey | HMUWNGCQNSOSBX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|