C16H15NO — CID 79739966
2-(5,6,7,8-tetrahydroquinolin-8-yl)benzaldehyde (PubChem CID 79739966) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydroquinolin-8-yl)benzaldehyde.
| Compound Name | 2-(5,6,7,8-tetrahydroquinolin-8-yl)benzaldehyde |
|---|---|
| PubChem CID | 79739966 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-(5,6,7,8-tetrahydroquinolin-8-yl)benzaldehyde |
| SMILES | O=Cc1ccccc1C1CCCc2cccnc21 |
| InChI | InChI=1S/C16H15NO/c18-11-13-5-1-2-8-14(13)15-9-3-6-12-7-4-10-17-16(12)15/h1-2,4-5,7-8,10-11,15H,3,6,9H2 |
| InChIKey | XMFAPERYWFLHOM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|