C16H14FNO — CID 79739656
2-fluoro-5-(5,6,7,8-tetrahydroquinolin-8-yl)benzaldehyde (PubChem CID 79739656) has the molecular formula C16H14FNO and a molecular weight of 255.29 g/mol. Its IUPAC name is 2-fluoro-5-(5,6,7,8-tetrahydroquinolin-8-yl)benzaldehyde.
| Compound Name | 2-fluoro-5-(5,6,7,8-tetrahydroquinolin-8-yl)benzaldehyde |
|---|---|
| PubChem CID | 79739656 |
| Molecular Formula | C16H14FNO |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-fluoro-5-(5,6,7,8-tetrahydroquinolin-8-yl)benzaldehyde |
| SMILES | O=Cc1cc(C2CCCc3cccnc32)ccc1F |
| InChI | InChI=1S/C16H14FNO/c17-15-7-6-12(9-13(15)10-19)14-5-1-3-11-4-2-8-18-16(11)14/h2,4,6-10,14H,1,3,5H2 |
| InChIKey | ITMIHEWBSYUCOY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|