C14H10ClF3N2 — CID 102716446
7-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 102716446) has the molecular formula C14H10ClF3N2 and a molecular weight of 298.70 g/mol. Its IUPAC name is 7-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-6,7-dihydro-5H-cyclopenta[b]pyridine.
| Compound Name | 7-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-6,7-dihydro-5H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 102716446 |
| Molecular Formula | C14H10ClF3N2 |
| Molecular Weight | 298.70 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 7-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | FC(F)(F)c1cc(Cl)nc(C2CCc3cccnc32)c1 |
| InChI | InChI=1S/C14H10ClF3N2/c15-12-7-9(14(16,17)18)6-11(20-12)10-4-3-8-2-1-5-19-13(8)10/h1-2,5-7,10H,3-4H2 |
| InChIKey | DKSINLSKCZHKJI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.70 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|