C15H17N3S — CID 106519088
5,6-dimethyl-3-(5,6,7,8-tetrahydroquinolin-8-yl)-1H-pyrazine-2-thione (PubChem CID 106519088) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is 5,6-dimethyl-3-(5,6,7,8-tetrahydroquinolin-8-yl)-1H-pyrazine-2-thione.
| Compound Name | 5,6-dimethyl-3-(5,6,7,8-tetrahydroquinolin-8-yl)-1H-pyrazine-2-thione |
|---|---|
| PubChem CID | 106519088 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 5,6-dimethyl-3-(5,6,7,8-tetrahydroquinolin-8-yl)-1H-pyrazine-2-thione |
| SMILES | Cc1nc(C2CCCc3cccnc32)c(=S)[nH]c1C |
| InChI | InChI=1S/C15H17N3S/c1-9-10(2)18-15(19)14(17-9)12-7-3-5-11-6-4-8-16-13(11)12/h4,6,8,12H,3,5,7H2,1-2H3,(H,18,19) |
| InChIKey | JCSDZRYGVLTKCD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|