C12H19NSi — CID 130535889
trimethyl(5,6,7,8-tetrahydroquinolin-8-yl)silane (PubChem CID 130535889) has the molecular formula C12H19NSi and a molecular weight of 205.38 g/mol. Its IUPAC name is trimethyl(5,6,7,8-tetrahydroquinolin-8-yl)silane.
| Compound Name | trimethyl(5,6,7,8-tetrahydroquinolin-8-yl)silane |
|---|---|
| PubChem CID | 130535889 |
| Molecular Formula | C12H19NSi |
| Molecular Weight | 205.38 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | trimethyl(5,6,7,8-tetrahydroquinolin-8-yl)silane |
| SMILES | C[Si](C)(C)C1CCCc2cccnc21 |
| InChI | InChI=1S/C12H19NSi/c1-14(2,3)11-8-4-6-10-7-5-9-13-12(10)11/h5,7,9,11H,4,6,8H2,1-3H3 |
| InChIKey | ZVWATBMBNFJHHV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|