C16H20N4 — CID 63251093
[6-ethyl-2-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidin-4-yl]hydrazine (PubChem CID 63251093) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is [6-ethyl-2-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-ethyl-2-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 63251093 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | [6-ethyl-2-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrimidin-4-yl]hydrazine |
| SMILES | CCc1cc(NN)nc(C2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C16H20N4/c1-2-12-10-15(20-17)19-16(18-12)14-9-5-7-11-6-3-4-8-13(11)14/h3-4,6,8,10,14H,2,5,7,9,17H2,1H3,(H,18,19,20) |
| InChIKey | DPYJEPKFTXUIGT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|