C16H18N4 — CID 65404645
[6-cyclopropyl-2-(2,3-dihydro-1H-inden-1-yl)pyrimidin-4-yl]hydrazine (PubChem CID 65404645) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is [6-cyclopropyl-2-(2,3-dihydro-1H-inden-1-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-cyclopropyl-2-(2,3-dihydro-1H-inden-1-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 65404645 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | [6-cyclopropyl-2-(2,3-dihydro-1H-inden-1-yl)pyrimidin-4-yl]hydrazine |
| SMILES | NNc1cc(C2CC2)nc(C2CCc3ccccc32)n1 |
| InChI | InChI=1S/C16H18N4/c17-20-15-9-14(11-5-6-11)18-16(19-15)13-8-7-10-3-1-2-4-12(10)13/h1-4,9,11,13H,5-8,17H2,(H,18,19,20) |
| InChIKey | MBUWNWIJGIMOGT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|