C10H10N4 — CID 14662611
5-(2,3-dihydro-1H-inden-1-yl)-2H-tetrazole (PubChem CID 14662611) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-1-yl)-2H-tetrazole.
| Compound Name | 5-(2,3-dihydro-1H-inden-1-yl)-2H-tetrazole |
|---|---|
| PubChem CID | 14662611 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-1-yl)-2H-tetrazole |
| SMILES | c1ccc2c(c1)CCC2c1nn[nH]n1 |
| InChI | InChI=1S/C10H10N4/c1-2-4-8-7(3-1)5-6-9(8)10-11-13-14-12-10/h1-4,9H,5-6H2,(H,11,12,13,14) |
| InChIKey | KOFCMWBKHFOHPL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |