C11H12N4 — CID 129369108
5-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2H-tetrazole (PubChem CID 129369108) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is 5-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2H-tetrazole.
| Compound Name | 5-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2H-tetrazole |
|---|---|
| PubChem CID | 129369108 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 5-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-2H-tetrazole |
| SMILES | c1ccc2c(c1)CCC[C@H]2c1nn[nH]n1 |
| InChI | InChI=1S/C11H12N4/c1-2-6-9-8(4-1)5-3-7-10(9)11-12-14-15-13-11/h1-2,4,6,10H,3,5,7H2,(H,12,13,14,15)/t10-/m1/s1 |
| InChIKey | DWBWEDMLSOJKOF-SNVBAGLBSA-N |
| XLogP | 1.67 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |