C12H12N4 — CID 66821619
5-(1,2,3,4-tetrahydronaphthalen-1-yl)tetrazine (PubChem CID 66821619) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 5-(1,2,3,4-tetrahydronaphthalen-1-yl)tetrazine.
| Compound Name | 5-(1,2,3,4-tetrahydronaphthalen-1-yl)tetrazine |
|---|---|
| PubChem CID | 66821619 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 5-(1,2,3,4-tetrahydronaphthalen-1-yl)tetrazine |
| SMILES | c1ccc2c(c1)CCCC2c1cnnnn1 |
| InChI | InChI=1S/C12H12N4/c1-2-6-10-9(4-1)5-3-7-11(10)12-8-13-15-16-14-12/h1-2,4,6,8,11H,3,5,7H2 |
| InChIKey | KTHYBUXSFQTQQE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |