C11H12Br2 — CID 10881240
(5R,6R)-5,6-dibromo-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 10881240) has the molecular formula C11H12Br2 and a molecular weight of 304.02 g/mol. Its IUPAC name is (5R,6R)-5,6-dibromo-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | (5R,6R)-5,6-dibromo-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 10881240 |
| Molecular Formula | C11H12Br2 |
| Molecular Weight | 304.02 g/mol |
| Exact Mass | 301.93 |
| IUPAC Name | (5R,6R)-5,6-dibromo-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | Br[C@@H]1CCCc2ccccc2[C@H]1Br |
| InChI | InChI=1S/C11H12Br2/c12-10-7-3-5-8-4-1-2-6-9(8)11(10)13/h1-2,4,6,10-11H,3,5,7H2/t10-,11-/m1/s1 |
| InChIKey | ZSGXAIRPNLSBNS-GHMZBOCLSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.02 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|