C10H13BrN2 — CID 124633942
[(1R,2S)-2-bromo-1,2,3,4-tetrahydronaphthalen-1-yl]hydrazine (PubChem CID 124633942) has the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. Its IUPAC name is [(1R,2S)-2-bromo-1,2,3,4-tetrahydronaphthalen-1-yl]hydrazine.
| Compound Name | [(1R,2S)-2-bromo-1,2,3,4-tetrahydronaphthalen-1-yl]hydrazine |
|---|---|
| PubChem CID | 124633942 |
| Molecular Formula | C10H13BrN2 |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | [(1R,2S)-2-bromo-1,2,3,4-tetrahydronaphthalen-1-yl]hydrazine |
| SMILES | NN[C@@H]1c2ccccc2CC[C@@H]1Br |
| InChI | InChI=1S/C10H13BrN2/c11-9-6-5-7-3-1-2-4-8(7)10(9)13-12/h1-4,9-10,13H,5-6,12H2/t9-,10+/m0/s1 |
| InChIKey | RDNNJBOPJQATNR-VHSXEESVSA-N |
| XLogP | 1.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|