C13H13BrO — CID 14469116
2-bromo-1-prop-2-ynoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 14469116) has the molecular formula C13H13BrO and a molecular weight of 265.15 g/mol. Its IUPAC name is 2-bromo-1-prop-2-ynoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-bromo-1-prop-2-ynoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 14469116 |
| Molecular Formula | C13H13BrO |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 2-bromo-1-prop-2-ynoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | C#CCOC1c2ccccc2CCC1Br |
| InChI | InChI=1S/C13H13BrO/c1-2-9-15-13-11-6-4-3-5-10(11)7-8-12(13)14/h1,3-6,12-13H,7-9H2 |
| InChIKey | AHGMXXPXQCTDSF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|