C17H16Br2O — CID 10475823
(1R,2R)-2-bromo-1-(2-bromo-4-methylphenoxy)-1,2,3,4-tetrahydronaphthalene (PubChem CID 10475823) has the molecular formula C17H16Br2O and a molecular weight of 396.12 g/mol. Its IUPAC name is (1R,2R)-2-bromo-1-(2-bromo-4-methylphenoxy)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R,2R)-2-bromo-1-(2-bromo-4-methylphenoxy)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 10475823 |
| Molecular Formula | C17H16Br2O |
| Molecular Weight | 396.12 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | (1R,2R)-2-bromo-1-(2-bromo-4-methylphenoxy)-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1ccc(O[C@@H]2c3ccccc3CC[C@H]2Br)c(Br)c1 |
| InChI | InChI=1S/C17H16Br2O/c1-11-6-9-16(15(19)10-11)20-17-13-5-3-2-4-12(13)7-8-14(17)18/h2-6,9-10,14,17H,7-8H2,1H3/t14-,17-/m1/s1 |
| InChIKey | LRKGTZAWRXBYQD-RHSMWYFYSA-N |
| XLogP | 5.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.12 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|