C19H21BrO3 — CID 134940287
(1R,2S)-2-bromo-1-(2,3,4-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 134940287) has the molecular formula C19H21BrO3 and a molecular weight of 377.28 g/mol. Its IUPAC name is (1R,2S)-2-bromo-1-(2,3,4-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R,2S)-2-bromo-1-(2,3,4-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 134940287 |
| Molecular Formula | C19H21BrO3 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | (1R,2S)-2-bromo-1-(2,3,4-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1ccc([C@H]2c3ccccc3CC[C@@H]2Br)c(OC)c1OC |
| InChI | InChI=1S/C19H21BrO3/c1-21-16-11-9-14(18(22-2)19(16)23-3)17-13-7-5-4-6-12(13)8-10-15(17)20/h4-7,9,11,15,17H,8,10H2,1-3H3/t15-,17+/m0/s1 |
| InChIKey | MOAAMTQCMHZPJD-DOTOQJQBSA-N |
| XLogP | 4.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|