C22H28IN — CID 23372178
1,1-dimethyl-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperidin-1-ium iodide (PubChem CID 23372178) has the molecular formula C22H28IN and a molecular weight of 433.38 g/mol. Its IUPAC name is 1,1-dimethyl-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperidin-1-ium iodide.
| Compound Name | 1,1-dimethyl-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperidin-1-ium iodide |
|---|---|
| PubChem CID | 23372178 |
| Molecular Formula | C22H28IN |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 1,1-dimethyl-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperidin-1-ium iodide |
| SMILES | C[N+]1(C)CCC(C2c3ccccc3CCc3ccccc32)CC1.[I-] |
| InChI | InChI=1S/C22H28N.HI/c1-23(2)15-13-19(14-16-23)22-20-9-5-3-7-17(20)11-12-18-8-4-6-10-21(18)22;/h3-10,19,22H,11-16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZWJVSZMESGXAQD-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|