C10H12NO+ — CID 10830482
2-methyl-4,8b-dihydro-3H-oxazireno[3,2-a]isoquinolin-2-ium (PubChem CID 10830482) has the molecular formula C10H12NO+ and a molecular weight of 162.21 g/mol. Its IUPAC name is 2-methyl-4,8b-dihydro-3H-oxazireno[3,2-a]isoquinolin-2-ium.
| Compound Name | 2-methyl-4,8b-dihydro-3H-oxazireno[3,2-a]isoquinolin-2-ium |
|---|---|
| PubChem CID | 10830482 |
| Molecular Formula | C10H12NO+ |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2-methyl-4,8b-dihydro-3H-oxazireno[3,2-a]isoquinolin-2-ium |
| SMILES | C[N+]12CCc3ccccc3C1O2 |
| InChI | InChI=1S/C10H12NO/c1-11-7-6-8-4-2-3-5-9(8)10(11)12-11/h2-5,10H,6-7H2,1H3/q+1 |
| InChIKey | IZKOQWQTZWIOFD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|