C21H25BrN2 — CID 11014501
(1R,2R)-11-methyl-14-aza-11-azoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-3,5,7,17,19,21-hexaene bromide (PubChem CID 11014501) has the molecular formula C21H25BrN2 and a molecular weight of 385.35 g/mol. Its IUPAC name is (1R,2R)-11-methyl-14-aza-11-azoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-3,5,7,17,19,21-hexaene bromide.
| Compound Name | (1R,2R)-11-methyl-14-aza-11-azoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-3,5,7,17,19,21-hexaene bromide |
|---|---|
| PubChem CID | 11014501 |
| Molecular Formula | C21H25BrN2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (1R,2R)-11-methyl-14-aza-11-azoniapentacyclo[12.8.0.02,11.03,8.017,22]docosa-3,5,7,17,19,21-hexaene bromide |
| SMILES | C[N+]12CCc3ccccc3[C@@H]1[C@H]1c3ccccc3CCN1CC2.[Br-] |
| InChI | InChI=1S/C21H25N2.BrH/c1-23-14-11-17-7-3-5-9-19(17)21(23)20-18-8-4-2-6-16(18)10-12-22(20)13-15-23;/h2-9,20-21H,10-15H2,1H3;1H/q+1;/p-1/t20-,21-,23?;/m1./s1 |
| InChIKey | NEAMPNIHRVNKCD-BVGNPBEMSA-M |
| XLogP | 0.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|