C18H21N — CID 169035410
13-methyl-6,8,8a,12a,13,13a-hexahydro-5H-isoquinolino[2,1-b]isoquinoline (PubChem CID 169035410) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is 13-methyl-6,8,8a,12a,13,13a-hexahydro-5H-isoquinolino[2,1-b]isoquinoline.
| Compound Name | 13-methyl-6,8,8a,12a,13,13a-hexahydro-5H-isoquinolino[2,1-b]isoquinoline |
|---|---|
| PubChem CID | 169035410 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 13-methyl-6,8,8a,12a,13,13a-hexahydro-5H-isoquinolino[2,1-b]isoquinoline |
| SMILES | CC1C2C=CC=CC2CN2CCc3ccccc3C12 |
| InChI | InChI=1S/C18H21N/c1-13-16-8-4-3-7-15(16)12-19-11-10-14-6-2-5-9-17(14)18(13)19/h2-9,13,15-16,18H,10-12H2,1H3 |
| InChIKey | UFKAPAWVBPXNFV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |