C13H15NO — CID 168764237
4,6,7,11b-tetrahydro-3H-benzo[a]quinolizin-2-ol (PubChem CID 168764237) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 4,6,7,11b-tetrahydro-3H-benzo[a]quinolizin-2-ol.
| Compound Name | 4,6,7,11b-tetrahydro-3H-benzo[a]quinolizin-2-ol |
|---|---|
| PubChem CID | 168764237 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 4,6,7,11b-tetrahydro-3H-benzo[a]quinolizin-2-ol |
| SMILES | OC1=CC2c3ccccc3CCN2CC1 |
| InChI | InChI=1S/C13H15NO/c15-11-6-8-14-7-5-10-3-1-2-4-12(10)13(14)9-11/h1-4,9,13,15H,5-8H2 |
| InChIKey | LPIOWWWCBNQGNE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |