C9H10N2 — CID 102362471
1,3,4,8b-tetrahydrodiazirino[3,1-a]isoquinoline (PubChem CID 102362471) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 1,3,4,8b-tetrahydrodiazirino[3,1-a]isoquinoline.
| Compound Name | 1,3,4,8b-tetrahydrodiazirino[3,1-a]isoquinoline |
|---|---|
| PubChem CID | 102362471 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 1,3,4,8b-tetrahydrodiazirino[3,1-a]isoquinoline |
| SMILES | c1ccc2c(c1)CCN1NC21 |
| InChI | InChI=1S/C9H10N2/c1-2-4-8-7(3-1)5-6-11-9(8)10-11/h1-4,9-10H,5-6H2 |
| InChIKey | BJMXPXPSUYUTIM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 24.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|