C11H16N2 — CID 141299186
(5S)-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-5-amine (PubChem CID 141299186) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (5S)-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-5-amine.
| Compound Name | (5S)-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-5-amine |
|---|---|
| PubChem CID | 141299186 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (5S)-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-5-amine |
| SMILES | CN1CCc2ccccc2[C@H](N)C1 |
| InChI | InChI=1S/C11H16N2/c1-13-7-6-9-4-2-3-5-10(9)11(12)8-13/h2-5,11H,6-8,12H2,1H3/t11-/m1/s1 |
| InChIKey | IVRQWKMFUDQDHH-LLVKDONJSA-N |
| XLogP | 1.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |