C11H17N — CID 161283116
methane;2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 161283116) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is methane;2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | methane;2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 161283116 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | methane;2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | C.CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C10H13N.CH4/c1-11-7-6-9-4-2-3-5-10(9)8-11;/h2-5H,6-8H2,1H3;1H4 |
| InChIKey | VFIVEAHTQOTSNY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |