C10H15NO4S — CID 173214818
hydrogen sulfate;hydron;2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 173214818) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is hydrogen sulfate;hydron;2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | hydrogen sulfate;hydron;2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 173214818 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | hydrogen sulfate;hydron;2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1CCc2ccccc2C1.O=S(=O)([O-])O.[H+] |
| InChI | InChI=1S/C10H13N.H2O4S/c1-11-7-6-9-4-2-3-5-10(9)8-11;1-5(2,3)4/h2-5H,6-8H2,1H3;(H2,1,2,3,4) |
| InChIKey | CTCWKDGCIGWXES-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|