C18H19NO — CID 168786379
6-methyl-5,7,8,14-tetrahydrobenzo[e][2]benzazecin-13-one (PubChem CID 168786379) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 6-methyl-5,7,8,14-tetrahydrobenzo[e][2]benzazecin-13-one.
| Compound Name | 6-methyl-5,7,8,14-tetrahydrobenzo[e][2]benzazecin-13-one |
|---|---|
| PubChem CID | 168786379 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 6-methyl-5,7,8,14-tetrahydrobenzo[e][2]benzazecin-13-one |
| SMILES | CN1CCc2ccccc2C(=O)Cc2ccccc2C1 |
| InChI | InChI=1S/C18H19NO/c1-19-11-10-14-6-4-5-9-17(14)18(20)12-15-7-2-3-8-16(15)13-19/h2-9H,10-13H2,1H3 |
| InChIKey | XJUREFHNEAJVHG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |