C17H21NO3S — CID 86651819
4-methylbenzenesulfonic acid;2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 86651819) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 4-methylbenzenesulfonic acid;2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 86651819 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4-methylbenzenesulfonic acid;2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1CCc2ccccc2C1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H13N.C7H8O3S/c1-11-7-6-9-4-2-3-5-10(9)8-11;1-6-2-4-7(5-3-6)11(8,9)10/h2-5H,6-8H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | OTEJFVUHRWMYCX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|