C16H14N2 — CID 76901069
1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbonitrile (PubChem CID 76901069) has the molecular formula C16H14N2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbonitrile.
| Compound Name | 1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbonitrile |
|---|---|
| PubChem CID | 76901069 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbonitrile |
| SMILES | N#CN1CCc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C16H14N2/c17-12-18-11-10-13-6-4-5-9-15(13)16(18)14-7-2-1-3-8-14/h1-9,16H,10-11H2 |
| InChIKey | RXWJCPBIJNPLIS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|