C20H20N2O — CID 11098751
(1R,2R)-11,14-diazapentacyclo[12.8.0.02,11.03,8.017,22]docosa-3,5,7,17,19,21-hexaen-12-one (PubChem CID 11098751) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is (1R,2R)-11,14-diazapentacyclo[12.8.0.02,11.03,8.017,22]docosa-3,5,7,17,19,21-hexaen-12-one.
| Compound Name | (1R,2R)-11,14-diazapentacyclo[12.8.0.02,11.03,8.017,22]docosa-3,5,7,17,19,21-hexaen-12-one |
|---|---|
| PubChem CID | 11098751 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (1R,2R)-11,14-diazapentacyclo[12.8.0.02,11.03,8.017,22]docosa-3,5,7,17,19,21-hexaen-12-one |
| SMILES | O=C1CN2CCc3ccccc3[C@@H]2[C@H]2c3ccccc3CCN12 |
| InChI | InChI=1S/C20H20N2O/c23-18-13-21-11-9-14-5-1-3-7-16(14)19(21)20-17-8-4-2-6-15(17)10-12-22(18)20/h1-8,19-20H,9-13H2/t19-,20-/m1/s1 |
| InChIKey | JPCUKGGHXPUMIE-WOJBJXKFSA-N |
| XLogP | 2.73 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |