C13H15NO — CID 13144291
1,2,3,6,7,11b-hexahydrobenzo[a]quinolizin-4-one (PubChem CID 13144291) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 1,2,3,6,7,11b-hexahydrobenzo[a]quinolizin-4-one.
| Compound Name | 1,2,3,6,7,11b-hexahydrobenzo[a]quinolizin-4-one |
|---|---|
| PubChem CID | 13144291 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1,2,3,6,7,11b-hexahydrobenzo[a]quinolizin-4-one |
| SMILES | O=C1CCCC2c3ccccc3CCN12 |
| InChI | InChI=1S/C13H15NO/c15-13-7-3-6-12-11-5-2-1-4-10(11)8-9-14(12)13/h1-2,4-5,12H,3,6-9H2 |
| InChIKey | WEAXKMDHHDNXKM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |