C13H16N2O — CID 124578698
1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]imidazolidin-2-one (PubChem CID 124578698) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]imidazolidin-2-one.
| Compound Name | 1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]imidazolidin-2-one |
|---|---|
| PubChem CID | 124578698 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]imidazolidin-2-one |
| SMILES | O=C1NCCN1[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C13H16N2O/c16-13-14-8-9-15(13)12-7-3-5-10-4-1-2-6-11(10)12/h1-2,4,6,12H,3,5,7-9H2,(H,14,16)/t12-/m0/s1 |
| InChIKey | AEBKMPHZMZYYEI-LBPRGKRZSA-N |
| XLogP | 2.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |