About 7-azatetracyclo[8.4.0.02,7.03,5]tetradeca-1(14),10,12-triene
7-azatetracyclo[8.4.0.02,7.03,5]tetradeca-1(14),10,12-triene (PubChem CID 105441719) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is 7-azatetracyclo[8.4.0.02,7.03,5]tetradeca-1(14),10,12-triene.
Analyze 7-azatetracyclo[8.4.0.02,7.03,5]tetradeca-1(14),10,12-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-azatetracyclo[8.4.0.02,7.03,5]tetradeca-1(14),10,12-triene?
The IUPAC name of 7-azatetracyclo[8.4.0.02,7.03,5]tetradeca-1(14),10,12-triene (CID 105441719) is 7-azatetracyclo[8.4.0.02,7.03,5]tetradeca-1(14),10,12-triene.
What is the SMILES notation for 7-azatetracyclo[8.4.0.02,7.03,5]tetradeca-1(14),10,12-triene?
The canonical SMILES for 7-azatetracyclo[8.4.0.02,7.03,5]tetradeca-1(14),10,12-triene is c1ccc2c(c1)CCN1CC3CC3C21.
What is the InChIKey of 7-azatetracyclo[8.4.0.02,7.03,5]tetradeca-1(14),10,12-triene?
The InChIKey is JMIPOUPZNDXKPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-2-4-11-9(3-1)5-6-14-8-10-7-12(10)13(11)14/h1-4,10,12-13H,5-8H2.
What are the key properties of 7-azatetracyclo[8.4.0.02,7.03,5]tetradeca-1(14),10,12-triene?
7-azatetracyclo[8.4.0.02,7.03,5]tetradeca-1(14),10,12-triene has a molecular weight of 185.27 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-azatetracyclo[8.4.0.02,7.03,5]tetradeca-1(14),10,12-triene is sourced from PubChem (CID 105441719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).