C13H17NO — CID 12786685
1-propan-2-yl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 12786685) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-propan-2-yl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | 1-propan-2-yl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 12786685 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-propan-2-yl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | CC(C)C1c2ccccc2CCN1C=O |
| InChI | InChI=1S/C13H17NO/c1-10(2)13-12-6-4-3-5-11(12)7-8-14(13)9-15/h3-6,9-10,13H,7-8H2,1-2H3 |
| InChIKey | ODQLTPHEFFVGCA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|