C13H19N — CID 10103975
(1S,2S)-1-ethyl-2-methanidyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium (PubChem CID 10103975) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (1S,2S)-1-ethyl-2-methanidyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium.
| Compound Name | (1S,2S)-1-ethyl-2-methanidyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium |
|---|---|
| PubChem CID | 10103975 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (1S,2S)-1-ethyl-2-methanidyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium |
| SMILES | [CH2-][N@+]1(C)CCc2ccccc2[C@@H]1CC |
| InChI | InChI=1S/C13H19N/c1-4-13-12-8-6-5-7-11(12)9-10-14(13,2)3/h5-8,13H,2,4,9-10H2,1,3H3/t13-,14-/m0/s1 |
| InChIKey | SSXHLCGKBRCQET-KBPBESRZSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|