C11H15N — CID 40527795
(1S)-1-ethyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 40527795) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (1S)-1-ethyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1S)-1-ethyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 40527795 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (1S)-1-ethyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC[C@@H]1NCCc2ccccc21 |
| InChI | InChI=1S/C11H15N/c1-2-11-10-6-4-3-5-9(10)7-8-12-11/h3-6,11-12H,2,7-8H2,1H3/t11-/m0/s1 |
| InChIKey | UDWVZWUSBKDYPY-NSHDSACASA-N |
| XLogP | 2.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |